C24H22N6O5 — CID 137070328
5-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-1-(2-ethylphenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 137070328) has the molecular formula C24H22N6O5 and a molecular weight of 474.48 g/mol. Its IUPAC name is 5-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-1-(2-ethylphenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-1-(2-ethylphenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070328 |
| Molecular Formula | C24H22N6O5 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 5-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-1-(2-ethylphenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1ccccc1-n1c(O)c(/C=N/c2c(C)nn(-c3ccc([N+](=O)[O-])cc3)c2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H22N6O5/c1-4-16-7-5-6-8-20(16)28-23(32)19(22(31)26-24(28)33)13-25-21-14(2)27-29(15(21)3)17-9-11-18(12-10-17)30(34)35/h5-13,32H,4H2,1-3H3,(H,26,31,33)/b25-13+ |
| InChIKey | RBYYADOWZQENJQ-DHRITJCHSA-N |
| XLogP | 3.26 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|