C24H23N5O3 — CID 137120832
5-[(1-benzyl-3,5-dimethylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione (PubChem CID 137120832) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 5-[(1-benzyl-3,5-dimethylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(1-benzyl-3,5-dimethylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137120832 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 5-[(1-benzyl-3,5-dimethylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3c(C)nn(Cc4ccccc4)c3C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C24H23N5O3/c1-15-9-11-19(12-10-15)29-23(31)20(22(30)26-24(29)32)13-25-21-16(2)27-28(17(21)3)14-18-7-5-4-6-8-18/h4-13,31H,14H2,1-3H3,(H,26,30,32)/b25-13+ |
| InChIKey | DFZDJRRBHQPIQM-DHRITJCHSA-N |
| XLogP | 3.15 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|