C13H10N6O3 — CID 135477983
6-hydroxy-1-phenyl-5-[(E)-1,2,4-triazol-4-yliminomethyl]pyrimidine-2,4-dione (PubChem CID 135477983) has the molecular formula C13H10N6O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is 6-hydroxy-1-phenyl-5-[(E)-1,2,4-triazol-4-yliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-phenyl-5-[(E)-1,2,4-triazol-4-yliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135477983 |
| Molecular Formula | C13H10N6O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 6-hydroxy-1-phenyl-5-[(E)-1,2,4-triazol-4-yliminomethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)c(O)c1/C=N/n1cnnc1 |
| InChI | InChI=1S/C13H10N6O3/c20-11-10(6-16-18-7-14-15-8-18)12(21)19(13(22)17-11)9-4-2-1-3-5-9/h1-8,21H,(H,17,20,22)/b16-6+ |
| InChIKey | MOSCFUYDWJUFMB-OMCISZLKSA-N |
| XLogP | -0.29 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|