C11H9N3O4 — CID 135512469
6-hydroxy-1-(4-methylphenyl)-5-nitrosopyrimidine-2,4-dione (PubChem CID 135512469) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methylphenyl)-5-nitrosopyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(4-methylphenyl)-5-nitrosopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135512469 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 6-hydroxy-1-(4-methylphenyl)-5-nitrosopyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(N=O)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H9N3O4/c1-6-2-4-7(5-3-6)14-10(16)8(13-18)9(15)12-11(14)17/h2-5,16H,1H3,(H,12,15,17) |
| InChIKey | FKFYGMIBPCYXDI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |