C17H12Br2N4O3 — CID 135460528
5-[(E)-(3,5-dibromo-2-pyridinyl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione (PubChem CID 135460528) has the molecular formula C17H12Br2N4O3 and a molecular weight of 480.12 g/mol. Its IUPAC name is 5-[(E)-(3,5-dibromo-2-pyridinyl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-(3,5-dibromo-2-pyridinyl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135460528 |
| Molecular Formula | C17H12Br2N4O3 |
| Molecular Weight | 480.12 g/mol |
| Exact Mass | 477.93 |
| IUPAC Name | 5-[(E)-(3,5-dibromo-2-pyridinyl)iminomethyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3ncc(Br)cc3Br)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H12Br2N4O3/c1-9-2-4-11(5-3-9)23-16(25)12(15(24)22-17(23)26)8-21-14-13(19)6-10(18)7-20-14/h2-8,25H,1H3,(H,22,24,26)/b21-8+ |
| InChIKey | JKBGSNWLCJRUOA-ODCIPOBUSA-N |
| XLogP | 3.21 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|