C16H11Br2ClN4O — CID 1353192
2-(4-chlorophenyl)-4-[(3,5-dibromo-2-pyridinyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 1353192) has the molecular formula C16H11Br2ClN4O and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[(3,5-dibromo-2-pyridinyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-chlorophenyl)-4-[(3,5-dibromo-2-pyridinyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 1353192 |
| Molecular Formula | C16H11Br2ClN4O |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 467.90 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[(3,5-dibromo-2-pyridinyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Cl)cc2)c(=O)c1C=Nc1ncc(Br)cc1Br |
| InChI | InChI=1S/C16H11Br2ClN4O/c1-9-13(8-21-15-14(18)6-10(17)7-20-15)16(24)23(22-9)12-4-2-11(19)3-5-12/h2-8,22H,1H3 |
| InChIKey | FDTIYCXULWKNPR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|