C14H15N5O4 — CID 5189325
[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]urea (PubChem CID 5189325) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is [1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]urea.
| Compound Name | [1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]urea |
|---|---|
| PubChem CID | 5189325 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]urea |
| SMILES | CC(=NNC(N)=O)c1c(O)n(-c2ccc(C)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H15N5O4/c1-7-3-5-9(6-4-7)19-12(21)10(11(20)16-14(19)23)8(2)17-18-13(15)22/h3-6,21H,1-2H3,(H3,15,18,22)(H,16,20,23) |
| InChIKey | IZVVEKVEHMUGGB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|