C18H22N4O4 — CID 3760321
N-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]pentanamide (PubChem CID 3760321) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]pentanamide.
| Compound Name | N-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]pentanamide |
|---|---|
| PubChem CID | 3760321 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]pentanamide |
| SMILES | CCCCC(=O)NN=C(C)c1c(O)n(-c2ccc(C)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N4O4/c1-4-5-6-14(23)21-20-12(3)15-16(24)19-18(26)22(17(15)25)13-9-7-11(2)8-10-13/h7-10,25H,4-6H2,1-3H3,(H,21,23)(H,19,24,26) |
| InChIKey | NIZIRYQENVTILZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|