C13H14N4O3 — CID 135451679
5-[(E)-N-anilino-C-ethylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 135451679) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-[(E)-N-anilino-C-ethylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-N-anilino-C-ethylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135451679 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-[(E)-N-anilino-C-ethylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | CC/C(=N\Nc1ccccc1)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H14N4O3/c1-2-9(17-16-8-6-4-3-5-7-8)10-11(18)14-13(20)15-12(10)19/h3-7,16H,2H2,1H3,(H3,14,15,18,19,20)/b17-9+ |
| InChIKey | UIXRVXSAKDGNCP-RQZCQDPDSA-N |
| XLogP | 1.00 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|