C14H16N6O4 — CID 135684639
2-[(E)-1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]guanidine (PubChem CID 135684639) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[(E)-1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 135684639 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[(E)-1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]ethylideneamino]guanidine |
| SMILES | COc1ccc(-n2c(O)c(/C(C)=N/N=C(N)N)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H16N6O4/c1-7(18-19-13(15)16)10-11(21)17-14(23)20(12(10)22)8-3-5-9(24-2)6-4-8/h3-6,22H,1-2H3,(H4,15,16,19)(H,17,21,23)/b18-7+ |
| InChIKey | COQZCOOYLQZWJH-CNHKJKLMSA-N |
| XLogP | -0.76 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|