C20H18FN3O4 — CID 3623610
5-[C-ethyl-N-(2-fluorophenyl)carbonimidoyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione (PubChem CID 3623610) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 5-[C-ethyl-N-(2-fluorophenyl)carbonimidoyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[C-ethyl-N-(2-fluorophenyl)carbonimidoyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3623610 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 5-[C-ethyl-N-(2-fluorophenyl)carbonimidoyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione |
| SMILES | CC/C(=N\c1ccccc1F)c1c(O)n(-c2ccc(OC)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H18FN3O4/c1-3-15(22-16-7-5-4-6-14(16)21)17-18(25)23-20(27)24(19(17)26)12-8-10-13(28-2)11-9-12/h4-11,26H,3H2,1-2H3,(H,23,25,27)/b22-15+ |
| InChIKey | PMSXQZVOGTXYJB-PXLXIMEGSA-N |
| XLogP | 2.91 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|