C22H30N6O4S — CID 3823420
4-[2-[1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]ethyl]-N-methylpiperazine-1-carbothioamide (PubChem CID 3823420) has the molecular formula C22H30N6O4S and a molecular weight of 474.59 g/mol. Its IUPAC name is 4-[2-[1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]ethyl]-N-methylpiperazine-1-carbothioamide.
| Compound Name | 4-[2-[1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]ethyl]-N-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3823420 |
| Molecular Formula | C22H30N6O4S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-[2-[1-[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]ethyl]-N-methylpiperazine-1-carbothioamide |
| SMILES | CC/C(=N\CCN1CCN(C(=S)NC)CC1)c1c(O)n(-c2ccc(OC)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30N6O4S/c1-4-17(24-9-10-26-11-13-27(14-12-26)22(33)23-2)18-19(29)25-21(31)28(20(18)30)15-5-7-16(32-3)8-6-15/h5-8,30H,4,9-14H2,1-3H3,(H,23,33)(H,25,29,31)/b24-17+ |
| InChIKey | XBRPKHUCRROOOF-JJIBRWJFSA-N |
| XLogP | 0.56 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|