C21H21N3O5 — CID 3719384
5-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione (PubChem CID 3719384) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3719384 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 5-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(/N=C(\C)c2c(O)n(-c3ccc(C)cc3)c(=O)[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C21H21N3O5/c1-12-5-7-14(8-6-12)24-20(26)18(19(25)23-21(24)27)13(2)22-16-10-9-15(28-3)11-17(16)29-4/h5-11,26H,1-4H3,(H,23,25,27)/b22-13+ |
| InChIKey | XMYJDUOPVJKDGZ-LPYMAVHISA-N |
| XLogP | 2.70 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|