C18H18N2O4 — CID 123618505
4-hydroxy-3-[4-(5-methoxy-2-methylphenoxy)phenyl]-5-methyl-1H-imidazol-2-one (PubChem CID 123618505) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-hydroxy-3-[4-(5-methoxy-2-methylphenoxy)phenyl]-5-methyl-1H-imidazol-2-one.
| Compound Name | 4-hydroxy-3-[4-(5-methoxy-2-methylphenoxy)phenyl]-5-methyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 123618505 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-hydroxy-3-[4-(5-methoxy-2-methylphenoxy)phenyl]-5-methyl-1H-imidazol-2-one |
| SMILES | COc1ccc(C)c(Oc2ccc(-n3c(O)c(C)[nH]c3=O)cc2)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-11-4-7-15(23-3)10-16(11)24-14-8-5-13(6-9-14)20-17(21)12(2)19-18(20)22/h4-10,21H,1-3H3,(H,19,22) |
| InChIKey | OTUUOOFPGDFTBK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |