C16H14N2O4 — CID 117261702
7-methoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione (PubChem CID 117261702) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 7-methoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-methoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261702 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 7-methoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(-n2c(=O)[nH]c3cc(OC)ccc3c2=O)cc1 |
| InChI | InChI=1S/C16H14N2O4/c1-21-11-5-3-10(4-6-11)18-15(19)13-8-7-12(22-2)9-14(13)17-16(18)20/h3-9H,1-2H3,(H,17,20) |
| InChIKey | HKDAYZBMHYHWSL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |