C13H10N2O3S — CID 117261301
6-methoxy-3-thiophen-2-yl-1H-quinazoline-2,4-dione (PubChem CID 117261301) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is 6-methoxy-3-thiophen-2-yl-1H-quinazoline-2,4-dione.
| Compound Name | 6-methoxy-3-thiophen-2-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261301 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 6-methoxy-3-thiophen-2-yl-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc2[nH]c(=O)n(-c3cccs3)c(=O)c2c1 |
| InChI | InChI=1S/C13H10N2O3S/c1-18-8-4-5-10-9(7-8)12(16)15(13(17)14-10)11-3-2-6-19-11/h2-7H,1H3,(H,14,17) |
| InChIKey | AMFGATCRZIYMQL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |