C18H13N3O3S — CID 10066534
3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-quinazoline-2,4-dione (PubChem CID 10066534) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10066534 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(-c2csc(-n3c(=O)[nH]c4ccccc4c3=O)n2)cc1 |
| InChI | InChI=1S/C18H13N3O3S/c1-24-12-8-6-11(7-9-12)15-10-25-18(20-15)21-16(22)13-4-2-3-5-14(13)19-17(21)23/h2-10H,1H3,(H,19,23) |
| InChIKey | PKEJKWCHOFUATH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |