C23H36N2O2 — CID 91492397
ethane;3-(4-methylphenyl)-1H-quinazoline-2,4-dione (PubChem CID 91492397) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is ethane;3-(4-methylphenyl)-1H-quinazoline-2,4-dione.
| Compound Name | ethane;3-(4-methylphenyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 91492397 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | ethane;3-(4-methylphenyl)-1H-quinazoline-2,4-dione |
| SMILES | CC.CC.CC.CC.Cc1ccc(-n2c(=O)[nH]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C15H12N2O2.4C2H6/c1-10-6-8-11(9-7-10)17-14(18)12-4-2-3-5-13(12)16-15(17)19;4*1-2/h2-9H,1H3,(H,16,19);4*1-2H3 |
| InChIKey | NUVXVGMGGMWZDU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |