C20H29N3O2 — CID 91428000
3-(4-aminophenyl)-1H-quinazoline-2,4-dione;ethane (PubChem CID 91428000) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1H-quinazoline-2,4-dione;ethane.
| Compound Name | 3-(4-aminophenyl)-1H-quinazoline-2,4-dione;ethane |
|---|---|
| PubChem CID | 91428000 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-(4-aminophenyl)-1H-quinazoline-2,4-dione;ethane |
| SMILES | CC.CC.CC.Nc1ccc(-n2c(=O)[nH]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C14H11N3O2.3C2H6/c15-9-5-7-10(8-6-9)17-13(18)11-3-1-2-4-12(11)16-14(17)19;3*1-2/h1-8H,15H2,(H,16,19);3*1-2H3 |
| InChIKey | FTWYZBRXTAVEFV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|