C16H14N2O2 — CID 12845269
3-(2,3-dimethylphenyl)-1H-quinazoline-2,4-dione (PubChem CID 12845269) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-(2,3-dimethylphenyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 12845269 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1H-quinazoline-2,4-dione |
| SMILES | Cc1cccc(-n2c(=O)[nH]c3ccccc3c2=O)c1C |
| InChI | InChI=1S/C16H14N2O2/c1-10-6-5-9-14(11(10)2)18-15(19)12-7-3-4-8-13(12)17-16(18)20/h3-9H,1-2H3,(H,17,20) |
| InChIKey | NMTZVLNVWYCIIR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |