C15H11N3O3 — CID 102282409
3-(4-aminophenyl)-1H-1,3-benzodiazepine-2,4,5-trione (PubChem CID 102282409) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1H-1,3-benzodiazepine-2,4,5-trione.
| Compound Name | 3-(4-aminophenyl)-1H-1,3-benzodiazepine-2,4,5-trione |
|---|---|
| PubChem CID | 102282409 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-(4-aminophenyl)-1H-1,3-benzodiazepine-2,4,5-trione |
| SMILES | Nc1ccc(-n2c(=O)[nH]c3ccccc3c(=O)c2=O)cc1 |
| InChI | InChI=1S/C15H11N3O3/c16-9-5-7-10(8-6-9)18-14(20)13(19)11-3-1-2-4-12(11)17-15(18)21/h1-8H,16H2,(H,17,21) |
| InChIKey | ZFFNSJNHAMJGMG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|