C28H18N4O2S2 — CID 15134035
3-[4-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 15134035) has the molecular formula C28H18N4O2S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-[4-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[4-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 15134035 |
| Molecular Formula | C28H18N4O2S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 3-[4-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1-c1ccc(-c2ccc(-n3c(=S)[nH]c4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C28H18N4O2S2/c33-25-21-5-1-3-7-23(21)29-27(35)31(25)19-13-9-17(10-14-19)18-11-15-20(16-12-18)32-26(34)22-6-2-4-8-24(22)30-28(32)36/h1-16H,(H,29,35)(H,30,36) |
| InChIKey | YWDQKVUZTYYQCA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|