C15H12N2OS2 — CID 23768763
3-(2-methylsulfanylphenyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 23768763) has the molecular formula C15H12N2OS2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-(2-methylsulfanylphenyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(2-methylsulfanylphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 23768763 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-(2-methylsulfanylphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CSc1ccccc1-n1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C15H12N2OS2/c1-20-13-9-5-4-8-12(13)17-14(18)10-6-2-3-7-11(10)16-15(17)19/h2-9H,1H3,(H,16,19) |
| InChIKey | GWIMLFSSVWQFLS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|