C15H11N3S2 — CID 107645339
1-(2-methylsulfanylphenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 107645339) has the molecular formula C15H11N3S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-(2-methylsulfanylphenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-(2-methylsulfanylphenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 107645339 |
| Molecular Formula | C15H11N3S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 1-(2-methylsulfanylphenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | CSc1ccccc1-n1c(=S)[nH]c2c(C#N)cccc21 |
| InChI | InChI=1S/C15H11N3S2/c1-20-13-8-3-2-6-11(13)18-12-7-4-5-10(9-16)14(12)17-15(18)19/h2-8H,1H3,(H,17,19) |
| InChIKey | YZASKEHJEYPXEE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|