C15H19N3S — CID 104718546
2-sulfanylidene-1-(2,3,3-trimethylbutyl)-3H-benzimidazole-4-carbonitrile (PubChem CID 104718546) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-sulfanylidene-1-(2,3,3-trimethylbutyl)-3H-benzimidazole-4-carbonitrile.
| Compound Name | 2-sulfanylidene-1-(2,3,3-trimethylbutyl)-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718546 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-sulfanylidene-1-(2,3,3-trimethylbutyl)-3H-benzimidazole-4-carbonitrile |
| SMILES | CC(Cn1c(=S)[nH]c2c(C#N)cccc21)C(C)(C)C |
| InChI | InChI=1S/C15H19N3S/c1-10(15(2,3)4)9-18-12-7-5-6-11(8-16)13(12)17-14(18)19/h5-7,10H,9H2,1-4H3,(H,17,19) |
| InChIKey | SLVNIBYTKZFEFI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|