C13H12N6S — CID 104718403
1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718403) has the molecular formula C13H12N6S and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718403 |
| Molecular Formula | C13H12N6S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | Cn1cnnc1CCn1c(=S)[nH]c2c(C#N)cccc21 |
| InChI | InChI=1S/C13H12N6S/c1-18-8-15-17-11(18)5-6-19-10-4-2-3-9(7-14)12(10)16-13(19)20/h2-4,8H,5-6H2,1H3,(H,16,20) |
| InChIKey | AXUOCQLLYXOPKK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|