C12H9N5OS — CID 104718324
1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718324) has the molecular formula C12H9N5OS and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718324 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | Cc1noc(Cn2c(=S)[nH]c3c(C#N)cccc32)n1 |
| InChI | InChI=1S/C12H9N5OS/c1-7-14-10(18-16-7)6-17-9-4-2-3-8(5-13)11(9)15-12(17)19/h2-4H,6H2,1H3,(H,15,19) |
| InChIKey | YCIYVUBSWPYRJG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|