C15H9ClFN3S — CID 104718369
1-[(3-chloro-4-fluorophenyl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718369) has the molecular formula C15H9ClFN3S and a molecular weight of 317.78 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718369 |
| Molecular Formula | C15H9ClFN3S |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1[nH]c(=S)n2Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H9ClFN3S/c16-11-6-9(4-5-12(11)17)8-20-13-3-1-2-10(7-18)14(13)19-15(20)21/h1-6H,8H2,(H,19,21) |
| InChIKey | PHZJTSWOFBFPNV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|