C13H11N5S — CID 104718535
1-[(1-methylpyrazol-3-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718535) has the molecular formula C13H11N5S and a molecular weight of 269.33 g/mol. Its IUPAC name is 1-[(1-methylpyrazol-3-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-[(1-methylpyrazol-3-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718535 |
| Molecular Formula | C13H11N5S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1-[(1-methylpyrazol-3-yl)methyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | Cn1ccc(Cn2c(=S)[nH]c3c(C#N)cccc32)n1 |
| InChI | InChI=1S/C13H11N5S/c1-17-6-5-10(16-17)8-18-11-4-2-3-9(7-14)12(11)15-13(18)19/h2-6H,8H2,1H3,(H,15,19) |
| InChIKey | QMAASYLQVNVLHA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 62.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|