C12H10Cl2N4S — CID 82872424
5,6-dichloro-3-[(1-methylpyrazol-3-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 82872424) has the molecular formula C12H10Cl2N4S and a molecular weight of 313.21 g/mol. Its IUPAC name is 5,6-dichloro-3-[(1-methylpyrazol-3-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 5,6-dichloro-3-[(1-methylpyrazol-3-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 82872424 |
| Molecular Formula | C12H10Cl2N4S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 5,6-dichloro-3-[(1-methylpyrazol-3-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cn1ccc(Cn2c(=S)[nH]c3cc(Cl)c(Cl)cc32)n1 |
| InChI | InChI=1S/C12H10Cl2N4S/c1-17-3-2-7(16-17)6-18-11-5-9(14)8(13)4-10(11)15-12(18)19/h2-5H,6H2,1H3,(H,15,19) |
| InChIKey | CNJCLFYZAZGFDZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|