C12H7Cl2FN2S2 — CID 66076922
6-chloro-3-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 66076922) has the molecular formula C12H7Cl2FN2S2 and a molecular weight of 333.24 g/mol. Its IUPAC name is 6-chloro-3-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66076922 |
| Molecular Formula | C12H7Cl2FN2S2 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 6-chloro-3-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Cl)[nH]c(=S)n2Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H7Cl2FN2S2/c13-7-3-9-10(4-8(7)15)17(12(18)16-9)5-6-1-2-11(14)19-6/h1-4H,5H2,(H,16,18) |
| InChIKey | SQMNTCYDQNUVJF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|