C11H8ClFN4OS — CID 66079048
6-chloro-5-fluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 66079048) has the molecular formula C11H8ClFN4OS and a molecular weight of 298.73 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-5-fluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66079048 |
| Molecular Formula | C11H8ClFN4OS |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 6-chloro-5-fluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1noc(Cn2c(=S)[nH]c3cc(Cl)c(F)cc32)n1 |
| InChI | InChI=1S/C11H8ClFN4OS/c1-5-14-10(18-16-5)4-17-9-3-7(13)6(12)2-8(9)15-11(17)19/h2-3H,4H2,1H3,(H,15,19) |
| InChIKey | WXRYPEMCLBSDAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|