C15H11ClF2N2S — CID 66078623
6-chloro-5-fluoro-3-[2-(2-fluorophenyl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 66078623) has the molecular formula C15H11ClF2N2S and a molecular weight of 324.78 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-[2-(2-fluorophenyl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-5-fluoro-3-[2-(2-fluorophenyl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66078623 |
| Molecular Formula | C15H11ClF2N2S |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 6-chloro-5-fluoro-3-[2-(2-fluorophenyl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Cl)[nH]c(=S)n2CCc1ccccc1F |
| InChI | InChI=1S/C15H11ClF2N2S/c16-10-7-13-14(8-12(10)18)20(15(21)19-13)6-5-9-3-1-2-4-11(9)17/h1-4,7-8H,5-6H2,(H,19,21) |
| InChIKey | DPJIORVAGAXSBS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|