C12H9ClFN3S2 — CID 66078864
6-chloro-5-fluoro-3-[2-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 66078864) has the molecular formula C12H9ClFN3S2 and a molecular weight of 313.81 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-[2-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-5-fluoro-3-[2-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66078864 |
| Molecular Formula | C12H9ClFN3S2 |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 6-chloro-5-fluoro-3-[2-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Cl)[nH]c(=S)n2CCc1nccs1 |
| InChI | InChI=1S/C12H9ClFN3S2/c13-7-5-9-10(6-8(7)14)17(12(18)16-9)3-1-11-15-2-4-19-11/h2,4-6H,1,3H2,(H,16,18) |
| InChIKey | USVFCSRCSLNVSX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|