About 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione
5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione (PubChem CID 103462845) has the molecular formula C13H16Cl2N2S
and a molecular weight of 303.26 g/mol. Its IUPAC name is 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione |
| PubChem CID | 103462845 |
| Molecular Formula | C13H16Cl2N2S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione |
| SMILES | CCC(C)(C)Cn1c(=S)[nH]c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C13H16Cl2N2S/c1-4-13(2,3)7-17-11-6-9(15)8(14)5-10(11)16-12(17)18/h5-6H,4,7H2,1-3H3,(H,16,18) |
| InChIKey | ZTAMSYPSQCLVFG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione?
The IUPAC name of 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione (CID 103462845) is 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione.
What is the SMILES notation for 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione?
The canonical SMILES for 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione is CCC(C)(C)Cn1c(=S)[nH]c2cc(Cl)c(Cl)cc21.
What is the InChIKey of 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione?
The InChIKey is ZTAMSYPSQCLVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2N2S/c1-4-13(2,3)7-17-11-6-9(15)8(14)5-10(11)16-12(17)18/h5-6H,4,7H2,1-3H3,(H,16,18).
What are the key properties of 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione?
5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione has a molecular weight of 303.26 g/mol, XLogP of 5.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-3-(2,2-dimethylbutyl)-1H-benzimidazole-2-thione is sourced from PubChem (CID 103462845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).