C14H18Cl2N2OS — CID 106005837
5,6-dichloro-3-(4-propan-2-yloxybutyl)-1H-benzimidazole-2-thione (PubChem CID 106005837) has the molecular formula C14H18Cl2N2OS and a molecular weight of 333.28 g/mol. Its IUPAC name is 5,6-dichloro-3-(4-propan-2-yloxybutyl)-1H-benzimidazole-2-thione.
| Compound Name | 5,6-dichloro-3-(4-propan-2-yloxybutyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106005837 |
| Molecular Formula | C14H18Cl2N2OS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5,6-dichloro-3-(4-propan-2-yloxybutyl)-1H-benzimidazole-2-thione |
| SMILES | CC(C)OCCCCn1c(=S)[nH]c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H18Cl2N2OS/c1-9(2)19-6-4-3-5-18-13-8-11(16)10(15)7-12(13)17-14(18)20/h7-9H,3-6H2,1-2H3,(H,17,20) |
| InChIKey | BXQJWGBTNHENSQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|