C11H11Cl2N3O2S — CID 106236090
2-[2-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)ethoxy]acetamide (PubChem CID 106236090) has the molecular formula C11H11Cl2N3O2S and a molecular weight of 320.20 g/mol. Its IUPAC name is 2-[2-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)ethoxy]acetamide.
| Compound Name | 2-[2-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)ethoxy]acetamide |
|---|---|
| PubChem CID | 106236090 |
| Molecular Formula | C11H11Cl2N3O2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-[2-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)ethoxy]acetamide |
| SMILES | NC(=O)COCCn1c(=S)[nH]c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C11H11Cl2N3O2S/c12-6-3-8-9(4-7(6)13)16(11(19)15-8)1-2-18-5-10(14)17/h3-4H,1-2,5H2,(H2,14,17)(H,15,19) |
| InChIKey | RYOFDAAGSGBFRA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|