C16H23ClN2S — CID 115470193
5-chloro-3-(2,2-dimethylheptyl)-1H-benzimidazole-2-thione (PubChem CID 115470193) has the molecular formula C16H23ClN2S and a molecular weight of 310.89 g/mol. Its IUPAC name is 5-chloro-3-(2,2-dimethylheptyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-(2,2-dimethylheptyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115470193 |
| Molecular Formula | C16H23ClN2S |
| Molecular Weight | 310.89 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-chloro-3-(2,2-dimethylheptyl)-1H-benzimidazole-2-thione |
| SMILES | CCCCCC(C)(C)Cn1c(=S)[nH]c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H23ClN2S/c1-4-5-6-9-16(2,3)11-19-14-10-12(17)7-8-13(14)18-15(19)20/h7-8,10H,4-6,9,11H2,1-3H3,(H,18,20) |
| InChIKey | DCNIKWSMBHDXDD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.89 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|