C15H12ClFN2S — CID 115469791
5-chloro-3-[2-(4-fluorophenyl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 115469791) has the molecular formula C15H12ClFN2S and a molecular weight of 306.79 g/mol. Its IUPAC name is 5-chloro-3-[2-(4-fluorophenyl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-[2-(4-fluorophenyl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115469791 |
| Molecular Formula | C15H12ClFN2S |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-chloro-3-[2-(4-fluorophenyl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc(CCn2c(=S)[nH]c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H12ClFN2S/c16-11-3-6-13-14(9-11)19(15(20)18-13)8-7-10-1-4-12(17)5-2-10/h1-6,9H,7-8H2,(H,18,20) |
| InChIKey | RGJWIATVKNTXCI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|