C16H15ClN2OS — CID 43659243
6-chloro-3-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 43659243) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 6-chloro-3-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 43659243 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 6-chloro-3-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | COc1ccc(CCn2c(=S)[nH]c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C16H15ClN2OS/c1-20-13-5-2-11(3-6-13)8-9-19-15-7-4-12(17)10-14(15)18-16(19)21/h2-7,10H,8-9H2,1H3,(H,18,21) |
| InChIKey | FDHLMRTWQLJEKG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|