C9H6ClF3N2S — CID 43659258
6-chloro-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione (PubChem CID 43659258) has the molecular formula C9H6ClF3N2S and a molecular weight of 266.68 g/mol. Its IUPAC name is 6-chloro-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 43659258 |
| Molecular Formula | C9H6ClF3N2S |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 6-chloro-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione |
| SMILES | FC(F)(F)Cn1c(=S)[nH]c2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H6ClF3N2S/c10-5-1-2-7-6(3-5)14-8(16)15(7)4-9(11,12)13/h1-3H,4H2,(H,14,16) |
| InChIKey | DGSXZPUMJNSBCA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|