C9H6F3IN2S — CID 66066675
6-iodo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione (PubChem CID 66066675) has the molecular formula C9H6F3IN2S and a molecular weight of 358.13 g/mol. Its IUPAC name is 6-iodo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-iodo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66066675 |
| Molecular Formula | C9H6F3IN2S |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 6-iodo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-2-thione |
| SMILES | FC(F)(F)Cn1c(=S)[nH]c2cc(I)ccc21 |
| InChI | InChI=1S/C9H6F3IN2S/c10-9(11,12)4-15-7-2-1-5(13)3-6(7)14-8(15)16/h1-3H,4H2,(H,14,16) |
| InChIKey | HPGIIFPAQQYNTO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|