C12H13N3S2 — CID 104718421
1-(3-methylsulfanylpropyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718421) has the molecular formula C12H13N3S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-(3-methylsulfanylpropyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718421 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | CSCCCn1c(=S)[nH]c2c(C#N)cccc21 |
| InChI | InChI=1S/C12H13N3S2/c1-17-7-3-6-15-10-5-2-4-9(8-13)11(10)14-12(15)16/h2,4-5H,3,6-7H2,1H3,(H,14,16) |
| InChIKey | MKSISUBFRHNYDY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|