C12H13N3S — CID 104718057
1-butyl-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718057) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-butyl-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-butyl-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718057 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-butyl-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | CCCCn1c(=S)[nH]c2c(C#N)cccc21 |
| InChI | InChI=1S/C12H13N3S/c1-2-3-7-15-10-6-4-5-9(8-13)11(10)14-12(15)16/h4-6H,2-3,7H2,1H3,(H,14,16) |
| InChIKey | AZYYJQXVZYFXJP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|