C15H8N4S — CID 104718152
1-(3-cyanophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718152) has the molecular formula C15H8N4S and a molecular weight of 276.32 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-(3-cyanophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718152 |
| Molecular Formula | C15H8N4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(3-cyanophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc(-n2c(=S)[nH]c3c(C#N)cccc32)c1 |
| InChI | InChI=1S/C15H8N4S/c16-8-10-3-1-5-12(7-10)19-13-6-2-4-11(9-17)14(13)18-15(19)20/h1-7H,(H,18,20) |
| InChIKey | CDYNVHOOHVWESN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|