C14H6BrCl2N3S — CID 107791503
1-(4-bromo-2,3-dichlorophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 107791503) has the molecular formula C14H6BrCl2N3S and a molecular weight of 399.10 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 107791503 |
| Molecular Formula | C14H6BrCl2N3S |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.88 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1[nH]c(=S)n2-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H6BrCl2N3S/c15-8-4-5-9(12(17)11(8)16)20-10-3-1-2-7(6-18)13(10)19-14(20)21/h1-5H,(H,19,21) |
| InChIKey | WVFWGYRIWNKVKD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|