C14H7BrCl2N4 — CID 107791599
2-amino-1-(4-bromo-2,3-dichlorophenyl)benzimidazole-4-carbonitrile (PubChem CID 107791599) has the molecular formula C14H7BrCl2N4 and a molecular weight of 382.05 g/mol. Its IUPAC name is 2-amino-1-(4-bromo-2,3-dichlorophenyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-amino-1-(4-bromo-2,3-dichlorophenyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 107791599 |
| Molecular Formula | C14H7BrCl2N4 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 2-amino-1-(4-bromo-2,3-dichlorophenyl)benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(N)n2-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H7BrCl2N4/c15-8-4-5-9(12(17)11(8)16)21-10-3-1-2-7(6-18)13(10)20-14(21)19/h1-5H,(H2,19,20) |
| InChIKey | JAZRMUDVVUQYJC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|