C15H12N4 — CID 104718715
2-amino-1-(2-methylphenyl)benzimidazole-4-carbonitrile (PubChem CID 104718715) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-amino-1-(2-methylphenyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-amino-1-(2-methylphenyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718715 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-amino-1-(2-methylphenyl)benzimidazole-4-carbonitrile |
| SMILES | Cc1ccccc1-n1c(N)nc2c(C#N)cccc21 |
| InChI | InChI=1S/C15H12N4/c1-10-5-2-3-7-12(10)19-13-8-4-6-11(9-16)14(13)18-15(19)17/h2-8H,1H3,(H2,17,18) |
| InChIKey | KVLBSHJUYYTJGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |