C14H8F2N4 — CID 104718691
2-amino-1-(3,4-difluorophenyl)benzimidazole-4-carbonitrile (PubChem CID 104718691) has the molecular formula C14H8F2N4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-amino-1-(3,4-difluorophenyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-amino-1-(3,4-difluorophenyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718691 |
| Molecular Formula | C14H8F2N4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-amino-1-(3,4-difluorophenyl)benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(N)n2-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8F2N4/c15-10-5-4-9(6-11(10)16)20-12-3-1-2-8(7-17)13(12)19-14(20)18/h1-6H,(H2,18,19) |
| InChIKey | QMGCPMGAYQLYRR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |