About 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile
2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile (PubChem CID 104718933) has the molecular formula C15H10F2N4
and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile |
| PubChem CID | 104718933 |
| Molecular Formula | C15H10F2N4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(N)n2Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H10F2N4/c16-11-5-4-10(12(17)6-11)8-21-13-3-1-2-9(7-18)14(13)20-15(21)19/h1-6H,8H2,(H2,19,20) |
| InChIKey | AEBPBCWGULUXDJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile?
The IUPAC name of 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile (CID 104718933) is 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile.
What is the SMILES notation for 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile?
The canonical SMILES for 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile is N#Cc1cccc2c1nc(N)n2Cc1ccc(F)cc1F.
What is the InChIKey of 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile?
The InChIKey is AEBPBCWGULUXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N4/c16-11-5-4-10(12(17)6-11)8-21-13-3-1-2-9(7-18)14(13)20-15(21)19/h1-6H,8H2,(H2,19,20).
What are the key properties of 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile?
2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile has a molecular weight of 284.27 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(2,4-difluorophenyl)methyl]benzimidazole-4-carbonitrile is sourced from PubChem (CID 104718933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).